How is adenosine synthesized?

Basically, the adenosine is formed as a result of a hydrolysis of AMP by action of a type I cytosolic 5-nucleotidase (reaction 2). Once the adenosine is formed, this can be phosphorylated by an adenosine kinase (reaction 1) or converted to inosine by adenosine deaminase action (reaction 5).

How is adenosine synthesized?

Basically, the adenosine is formed as a result of a hydrolysis of AMP by action of a type I cytosolic 5-nucleotidase (reaction 2). Once the adenosine is formed, this can be phosphorylated by an adenosine kinase (reaction 1) or converted to inosine by adenosine deaminase action (reaction 5).

What is the formula of adenine?

C5H5N5Adenine / Formula
Adenine’s chemical formula is C5H5N5. Adenine’s mol. Weight is 135.127. Adenine is one of the two purine nucleobases used in forming nucleotides of the nucleic acids.

What is adenosine neurotransmitter?

In the brain adenosine is an inhibitory neurotransmitter. This means, adenosine can act as a central nervous system depressant. In normal conditions, it promotes sleep and suppresses arousal. When awake the levels of adenosine in the brain rise each hour.

Where is adenosine triphosphate produced?

mitochondria
Most of the ATP in cells is produced by the enzyme ATP synthase, which converts ADP and phosphate to ATP. ATP synthase is located in the membrane of cellular structures called mitochondria; in plant cells, the enzyme also is found in chloroplasts.

How is adenosine metabolized?

Drug Metabolism Adenosine has a rapid onset of action with a very short half-life and undergoes rapid intracellular metabolism, either by phosphorylation, forming adenosine monophosphate, or deamination.

What is the Iupac name of cytosine?

IUPAC Name 6-amino-1H-pyrimidin-2-one
Alternative Names cytosine 4-Amino-2-hydroxypyrimidine 4-Amino-2(1H)-pyrimidinone 2(1H)-Pyrimidinone, 4-amino- 4-aminopyrimidin-2(1H)-one Cyt
Molecular Formula C4H5N3O
Molar Mass 111.104 g/mol
InChI InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)

Can you supplement adenosine triphosphate?

Nutritional supplements designed to increase adenosine 5′-triphosphate (ATP) concentrations are commonly used by athletes as ergogenic aids. ATP is the primary source of energy for the cells, and supplementation may enhance the ability to maintain high ATP turnover during high-intensity exercise.

How do you get adenosine triphosphate?

ATP is also formed from the process of cellular respiration in the mitochondria of a cell. This can be through aerobic respiration, which requires oxygen, or anaerobic respiration, which does not. Aerobic respiration produces ATP (along with carbon dioxide and water) from glucose and oxygen.

What type of drug is adenosine?

Adenosine further classifies as a miscellaneous antiarrhythmic drug outside the Vaughan-Williams classification scheme. It acts on receptors in the cardiac AV node, significantly slowing conduction time.

What is adenosine injection used for?

What is this medicine? ADENOSINE (a DEN uh seen) is used to bring your heart back into a normal rhythm. This medicine is not useful for all types of irregular heart beats. It may be used to test the heart for coronary artery disease.